C18H18Cl2N2O3 — CID 110515613
N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide (PubChem CID 110515613) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 110515613 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide |
| SMILES | CC(C)Oc1c(Cl)cc(/C=N\NC(=O)Cc2ccc(O)cc2)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-11(2)25-18-15(19)7-13(8-16(18)20)10-21-22-17(24)9-12-3-5-14(23)6-4-12/h3-8,10-11,23H,9H2,1-2H3,(H,22,24)/b21-10- |
| InChIKey | JOLXLYRXLKRNDJ-FBHDLOMBSA-N |
| XLogP | 4.18 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|