C17H16Cl3N3O2 — CID 110532392
1-(4-chlorophenyl)-3-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]urea (PubChem CID 110532392) has the molecular formula C17H16Cl3N3O2 and a molecular weight of 400.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 110532392 |
| Molecular Formula | C17H16Cl3N3O2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(Z)-(3,5-dichloro-4-propan-2-yloxyphenyl)methylideneamino]urea |
| SMILES | CC(C)Oc1c(Cl)cc(/C=N\NC(=O)Nc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C17H16Cl3N3O2/c1-10(2)25-16-14(19)7-11(8-15(16)20)9-21-23-17(24)22-13-5-3-12(18)4-6-13/h3-10H,1-2H3,(H2,22,23,24)/b21-9- |
| InChIKey | SEFDIPCXDGKEMM-NKVSQWTQSA-N |
| XLogP | 5.59 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|