C25H28N2O3S — CID 110515925
5-tert-butyl-2-methyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 110515925) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 5-tert-butyl-2-methyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 110515925 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-tert-butyl-2-methyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N/N=C/c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-19-14-15-22(25(2,3)4)16-24(19)31(28,29)27-26-17-21-12-8-9-13-23(21)30-18-20-10-6-5-7-11-20/h5-17,27H,18H2,1-4H3/b26-17+ |
| InChIKey | MAUUQSSBHWUAJV-YZSQISJMSA-N |
| XLogP | 5.18 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|