C21H25N3O2S — CID 136789485
5-tert-butyl-2-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzenesulfonamide (PubChem CID 136789485) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 5-tert-butyl-2-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 136789485 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5-tert-butyl-2-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N/N=C/c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H25N3O2S/c1-14-10-11-16(21(3,4)5)12-20(14)27(25,26)24-22-13-18-15(2)23-19-9-7-6-8-17(18)19/h6-13,23-24H,1-5H3/b22-13+ |
| InChIKey | HGQKDRCUOHHZIJ-LPYMAVHISA-N |
| XLogP | 4.39 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|