C13H12N4S3 — CID 110521089
4-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110521089) has the molecular formula C13H12N4S3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 4-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521089 |
| Molecular Formula | C13H12N4S3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-[(Z)-(3-methylthiophen-2-yl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccsc1/C=N\n1c(Cc2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C13H12N4S3/c1-9-4-6-20-11(9)8-14-17-12(15-16-13(17)18)7-10-3-2-5-19-10/h2-6,8H,7H2,1H3,(H,16,18)/b14-8- |
| InChIKey | LQWWZCHTLHTDRO-ZSOIEALJSA-N |
| XLogP | 3.85 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|