C11H22O2 — CID 11052356
(E)-3-ethyl-1,1-dimethoxyhept-2-ene (PubChem CID 11052356) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (E)-3-ethyl-1,1-dimethoxyhept-2-ene.
| Compound Name | (E)-3-ethyl-1,1-dimethoxyhept-2-ene |
|---|---|
| PubChem CID | 11052356 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (E)-3-ethyl-1,1-dimethoxyhept-2-ene |
| SMILES | CCCC/C(=C/C(OC)OC)CC |
| InChI | InChI=1S/C11H22O2/c1-5-7-8-10(6-2)9-11(12-3)13-4/h9,11H,5-8H2,1-4H3/b10-9+ |
| InChIKey | KJLIYJQSQPRPEA-MDZDMXLPSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|