C11H20O3 — CID 87458254
(3Z)-3-(2,2-dimethoxyethylidene)heptan-2-one (PubChem CID 87458254) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3Z)-3-(2,2-dimethoxyethylidene)heptan-2-one.
| Compound Name | (3Z)-3-(2,2-dimethoxyethylidene)heptan-2-one |
|---|---|
| PubChem CID | 87458254 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (3Z)-3-(2,2-dimethoxyethylidene)heptan-2-one |
| SMILES | CCCC/C(=C/C(OC)OC)C(C)=O |
| InChI | InChI=1S/C11H20O3/c1-5-6-7-10(9(2)12)8-11(13-3)14-4/h8,11H,5-7H2,1-4H3/b10-8- |
| InChIKey | JFPNPWIWBYYMSK-NTMALXAHSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|