C16H30O2 — CID 174255990
(4S,5E)-6-ethyl-4-methoxy-3,3-dimethylundeca-1,5-dien-2-ol (PubChem CID 174255990) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (4S,5E)-6-ethyl-4-methoxy-3,3-dimethylundeca-1,5-dien-2-ol.
| Compound Name | (4S,5E)-6-ethyl-4-methoxy-3,3-dimethylundeca-1,5-dien-2-ol |
|---|---|
| PubChem CID | 174255990 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (4S,5E)-6-ethyl-4-methoxy-3,3-dimethylundeca-1,5-dien-2-ol |
| SMILES | C=C(O)C(C)(C)[C@H](/C=C(\CC)CCCCC)OC |
| InChI | InChI=1S/C16H30O2/c1-7-9-10-11-14(8-2)12-15(18-6)16(4,5)13(3)17/h12,15,17H,3,7-11H2,1-2,4-6H3/b14-12+/t15-/m0/s1 |
| InChIKey | JRKYDWWOWVHAKC-ZQHYZAEZSA-N |
| XLogP | 5.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|