C21H25ClN2O4 — CID 110524963
2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 110524963) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110524963 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(2-chloro-5-methoxyphenyl)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)Cc2cc(OC)ccc2Cl)cc1OCC |
| InChI | InChI=1S/C21H25ClN2O4/c1-4-10-28-19-9-6-15(11-20(19)27-5-2)14-23-24-21(25)13-16-12-17(26-3)7-8-18(16)22/h6-9,11-12,14H,4-5,10,13H2,1-3H3,(H,24,25)/b23-14+ |
| InChIKey | BEGHRKWYWHVUQX-OEAKJJBVSA-N |
| XLogP | 4.23 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|