C26H29N5O2 — CID 110527419
6-phenyl-2-piperidin-1-yl-N-[(E)-(4-propoxyphenyl)methylideneamino]pyrimidine-4-carboxamide (PubChem CID 110527419) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-phenyl-2-piperidin-1-yl-N-[(E)-(4-propoxyphenyl)methylideneamino]pyrimidine-4-carboxamide.
| Compound Name | 6-phenyl-2-piperidin-1-yl-N-[(E)-(4-propoxyphenyl)methylideneamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110527419 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6-phenyl-2-piperidin-1-yl-N-[(E)-(4-propoxyphenyl)methylideneamino]pyrimidine-4-carboxamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)c2cc(-c3ccccc3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H29N5O2/c1-2-17-33-22-13-11-20(12-14-22)19-27-30-25(32)24-18-23(21-9-5-3-6-10-21)28-26(29-24)31-15-7-4-8-16-31/h3,5-6,9-14,18-19H,2,4,7-8,15-17H2,1H3,(H,30,32)/b27-19+ |
| InChIKey | KMKOIEZZFQELSE-ZXVVBBHZSA-N |
| XLogP | 4.69 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|