C22H22N4O3 — CID 110525978
6-methyl-2-oxo-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-pyrimidine-4-carboxamide (PubChem CID 110525978) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-methyl-2-oxo-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-pyrimidine-4-carboxamide.
| Compound Name | 6-methyl-2-oxo-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110525978 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 6-methyl-2-oxo-N-[(E)-[4-(3-phenylpropoxy)phenyl]methylideneamino]-1H-pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2ccc(OCCCc3ccccc3)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C22H22N4O3/c1-16-14-20(25-22(28)24-16)21(27)26-23-15-18-9-11-19(12-10-18)29-13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,26,27)(H,24,25,28)/b23-15+ |
| InChIKey | RUQSYQBMTDSVQY-HZHRSRAPSA-N |
| XLogP | 2.85 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|