C25H24N4O2S — CID 110522669
2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]acetamide (PubChem CID 110522669) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 110522669 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[4-(3-phenylpropoxy)phenyl]methylideneamino]acetamide |
| SMILES | Nc1nc2ccc(CC(=O)N/N=C\c3ccc(OCCCc4ccccc4)cc3)cc2s1 |
| InChI | InChI=1S/C25H24N4O2S/c26-25-28-22-13-10-20(15-23(22)32-25)16-24(30)29-27-17-19-8-11-21(12-9-19)31-14-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-13,15,17H,4,7,14,16H2,(H2,26,28)(H,29,30)/b27-17- |
| InChIKey | BYGCWZSZUVTGKZ-PKAZHMFMSA-N |
| XLogP | 4.58 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|