C23H19ClN4O2S — CID 110522694
2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 110522694) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110522694 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | Nc1nc2ccc(CC(=O)N/N=C\c3ccc(OCc4ccccc4)c(Cl)c3)cc2s1 |
| InChI | InChI=1S/C23H19ClN4O2S/c24-18-10-17(7-9-20(18)30-14-15-4-2-1-3-5-15)13-26-28-22(29)12-16-6-8-19-21(11-16)31-23(25)27-19/h1-11,13H,12,14H2,(H2,25,27)(H,28,29)/b26-13- |
| InChIKey | RRVPVPYXTYEZEH-ZMFRSBBQSA-N |
| XLogP | 4.80 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|