C24H22N4O2S — CID 110522643
2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 110522643) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 110522643 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-[2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(COc2ccccc2/C=N\NC(=O)Cc2ccc3nc(N)sc3c2)cc1 |
| InChI | InChI=1S/C24H22N4O2S/c1-16-6-8-17(9-7-16)15-30-21-5-3-2-4-19(21)14-26-28-23(29)13-18-10-11-20-22(12-18)31-24(25)27-20/h2-12,14H,13,15H2,1H3,(H2,25,27)(H,28,29)/b26-14- |
| InChIKey | OTHHYIXSCKPHGM-WGARJPEWSA-N |
| XLogP | 4.46 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|