C19H20N4O3S — CID 110522633
2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 110522633) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110522633 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc3nc(N)sc3c2)ccc1OC |
| InChI | InChI=1S/C19H20N4O3S/c1-3-26-16-8-13(5-7-15(16)25-2)11-21-23-18(24)10-12-4-6-14-17(9-12)27-19(20)22-14/h4-9,11H,3,10H2,1-2H3,(H2,20,22)(H,23,24)/b21-11- |
| InChIKey | ZOYCGDAZMPSLKW-NHDPSOOVSA-N |
| XLogP | 2.98 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|