C16H13ClN4O2S — CID 136874296
2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136874296) has the molecular formula C16H13ClN4O2S and a molecular weight of 360.83 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136874296 |
| Molecular Formula | C16H13ClN4O2S |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-N-[(Z)-(3-chloro-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Nc1nc2ccc(CC(=O)N/N=C\c3ccc(O)c(Cl)c3)cc2s1 |
| InChI | InChI=1S/C16H13ClN4O2S/c17-11-5-10(2-4-13(11)22)8-19-21-15(23)7-9-1-3-12-14(6-9)24-16(18)20-12/h1-6,8,22H,7H2,(H2,18,20)(H,21,23)/b19-8- |
| InChIKey | MOGMJEKSNIKJSK-UWVJOHFNSA-N |
| XLogP | 2.93 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|