C14H24O — CID 11052868
(3S,3aR,8aR)-3,5,5,8-tetramethyl-1,2,3,4,6,8a-hexahydroazulen-3a-ol (PubChem CID 11052868) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (3S,3aR,8aR)-3,5,5,8-tetramethyl-1,2,3,4,6,8a-hexahydroazulen-3a-ol.
| Compound Name | (3S,3aR,8aR)-3,5,5,8-tetramethyl-1,2,3,4,6,8a-hexahydroazulen-3a-ol |
|---|---|
| PubChem CID | 11052868 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3S,3aR,8aR)-3,5,5,8-tetramethyl-1,2,3,4,6,8a-hexahydroazulen-3a-ol |
| SMILES | CC1=CCC(C)(C)C[C@]2(O)[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C14H24O/c1-10-7-8-13(3,4)9-14(15)11(2)5-6-12(10)14/h7,11-12,15H,5-6,8-9H2,1-4H3/t11-,12+,14+/m0/s1 |
| InChIKey | AGRHRJGQAGGMMQ-OUCADQQQSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|