C26H25N3O4 — CID 110530230
5-(2,4-diethoxy-5-nitrophenyl)-1,2,3,4-tetrahydronaphtho[2,1-c][2,7]naphthyridine (PubChem CID 110530230) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 5-(2,4-diethoxy-5-nitrophenyl)-1,2,3,4-tetrahydronaphtho[2,1-c][2,7]naphthyridine.
| Compound Name | 5-(2,4-diethoxy-5-nitrophenyl)-1,2,3,4-tetrahydronaphtho[2,1-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 110530230 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 5-(2,4-diethoxy-5-nitrophenyl)-1,2,3,4-tetrahydronaphtho[2,1-c][2,7]naphthyridine |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1-c1nc2ccc3ccccc3c2c2c1CNCC2 |
| InChI | InChI=1S/C26H25N3O4/c1-3-32-23-14-24(33-4-2)22(29(30)31)13-19(23)26-20-15-27-12-11-18(20)25-17-8-6-5-7-16(17)9-10-21(25)28-26/h5-10,13-14,27H,3-4,11-12,15H2,1-2H3 |
| InChIKey | HLDUEQCBOVZDGO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|