C22H15N2O3- — CID 6967825
2-(11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,11,13(17)-heptaen-12-yl)-4-nitrophenolate (PubChem CID 6967825) has the molecular formula C22H15N2O3- and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-(11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,11,13(17)-heptaen-12-yl)-4-nitrophenolate.
| Compound Name | 2-(11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,11,13(17)-heptaen-12-yl)-4-nitrophenolate |
|---|---|
| PubChem CID | 6967825 |
| Molecular Formula | C22H15N2O3- |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-(11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,11,13(17)-heptaen-12-yl)-4-nitrophenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(-c2nc3ccc4ccccc4c3c3c2CCC3)c1 |
| InChI | InChI=1S/C22H16N2O3/c25-20-11-9-14(24(26)27)12-18(20)22-17-7-3-6-16(17)21-15-5-2-1-4-13(15)8-10-19(21)23-22/h1-2,4-5,8-12,25H,3,6-7H2/p-1 |
| InChIKey | AEYYPDZVPRHNLC-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 79.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|