C25H21N3O4 — CID 44614223
ethyl 5-(4-nitrophenyl)-2,4-dihydro-1H-naphtho[1,2-f][2,7]naphthyridine-3-carboxylate (PubChem CID 44614223) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is ethyl 5-(4-nitrophenyl)-2,4-dihydro-1H-naphtho[1,2-f][2,7]naphthyridine-3-carboxylate.
| Compound Name | ethyl 5-(4-nitrophenyl)-2,4-dihydro-1H-naphtho[1,2-f][2,7]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 44614223 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | ethyl 5-(4-nitrophenyl)-2,4-dihydro-1H-naphtho[1,2-f][2,7]naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(c(-c3ccc([N+](=O)[O-])cc3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C25H21N3O4/c1-2-32-25(29)27-14-13-20-21(15-27)24(17-7-10-18(11-8-17)28(30)31)26-22-12-9-16-5-3-4-6-19(16)23(20)22/h3-12H,2,13-15H2,1H3 |
| InChIKey | OCLDYVXWISAEFI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|