C26H25N3O3 — CID 110530904
5-(4-methoxy-3-nitrophenyl)-3-propyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine (PubChem CID 110530904) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 5-(4-methoxy-3-nitrophenyl)-3-propyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine.
| Compound Name | 5-(4-methoxy-3-nitrophenyl)-3-propyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 110530904 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 5-(4-methoxy-3-nitrophenyl)-3-propyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
| SMILES | CCCN1CCc2c(c(-c3ccc(OC)c([N+](=O)[O-])c3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C26H25N3O3/c1-3-13-28-14-12-20-21(16-28)26(18-9-11-24(32-2)23(15-18)29(30)31)27-22-10-8-17-6-4-5-7-19(17)25(20)22/h4-11,15H,3,12-14,16H2,1-2H3 |
| InChIKey | DRIGNUVNACDYFO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|