C26H27N3 — CID 110533610
4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-N,N-dimethylaniline (PubChem CID 110533610) has the molecular formula C26H27N3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 110533610 |
| Molecular Formula | C26H27N3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-N,N-dimethylaniline |
| SMILES | CCN1CCc2c(c(-c3ccc(N(C)C)cc3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C26H27N3/c1-4-29-16-15-22-23(17-29)26(19-9-12-20(13-10-19)28(2)3)27-24-14-11-18-7-5-6-8-21(18)25(22)24/h5-14H,4,15-17H2,1-3H3 |
| InChIKey | YJLMHAMUTHSRNK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|