C26H23F3N2 — CID 110531259
3-propyl-5-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine (PubChem CID 110531259) has the molecular formula C26H23F3N2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-propyl-5-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine.
| Compound Name | 3-propyl-5-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 110531259 |
| Molecular Formula | C26H23F3N2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-propyl-5-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
| SMILES | CCCN1CCc2c(c(-c3cccc(C(F)(F)F)c3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C26H23F3N2/c1-2-13-31-14-12-21-22(16-31)25(18-7-5-8-19(15-18)26(27,28)29)30-23-11-10-17-6-3-4-9-20(17)24(21)23/h3-11,15H,2,12-14,16H2,1H3 |
| InChIKey | WWVCLWSIOKSXEW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|