C28H30N2O2 — CID 110530940
3-ethyl-5-(4-methoxy-3-propan-2-yloxyphenyl)-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine (PubChem CID 110530940) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-ethyl-5-(4-methoxy-3-propan-2-yloxyphenyl)-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine.
| Compound Name | 3-ethyl-5-(4-methoxy-3-propan-2-yloxyphenyl)-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 110530940 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-ethyl-5-(4-methoxy-3-propan-2-yloxyphenyl)-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridine |
| SMILES | CCN1CCc2c(c(-c3ccc(OC)c(OC(C)C)c3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C28H30N2O2/c1-5-30-15-14-22-23(17-30)28(20-11-13-25(31-4)26(16-20)32-18(2)3)29-24-12-10-19-8-6-7-9-21(19)27(22)24/h6-13,16,18H,5,14-15,17H2,1-4H3 |
| InChIKey | YHWMCIKGNGGDOS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|