C25H23ClN2O2 — CID 136781639
2-chloro-4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-6-methoxyphenol (PubChem CID 136781639) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-chloro-4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-6-methoxyphenol.
| Compound Name | 2-chloro-4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-6-methoxyphenol |
|---|---|
| PubChem CID | 136781639 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-chloro-4-(3-ethyl-2,4-dihydro-1H-naphtho[2,1-c][2,7]naphthyridin-5-yl)-6-methoxyphenol |
| SMILES | CCN1CCc2c(c(-c3cc(Cl)c(O)c(OC)c3)nc3ccc4ccccc4c23)C1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-3-28-11-10-18-19(14-28)24(16-12-20(26)25(29)22(13-16)30-2)27-21-9-8-15-6-4-5-7-17(15)23(18)21/h4-9,12-13,29H,3,10-11,14H2,1-2H3 |
| InChIKey | ZRCGVVKWWUOIOO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|