C15H17Br2NO2 — CID 110532280
(3E)-3-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 110532280) has the molecular formula C15H17Br2NO2 and a molecular weight of 403.11 g/mol. Its IUPAC name is (3E)-3-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3E)-3-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 110532280 |
| Molecular Formula | C15H17Br2NO2 |
| Molecular Weight | 403.11 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | (3E)-3-[(3,5-dibromo-4-ethoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CCOc1c(Br)cc(/C=C2\CN(C)CCC2=O)cc1Br |
| InChI | InChI=1S/C15H17Br2NO2/c1-3-20-15-12(16)7-10(8-13(15)17)6-11-9-18(2)5-4-14(11)19/h6-8H,3-5,9H2,1-2H3/b11-6+ |
| InChIKey | PPIMFWIYZAOKEM-IZZDOVSWSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|