C15H20O2 — CID 11053503
methyl (1R,2R,5S,8S)-2,5-dimethyltricyclo[6.3.0.01,5]undeca-3,9-diene-3-carboxylate (PubChem CID 11053503) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is methyl (1R,2R,5S,8S)-2,5-dimethyltricyclo[6.3.0.01,5]undeca-3,9-diene-3-carboxylate.
| Compound Name | methyl (1R,2R,5S,8S)-2,5-dimethyltricyclo[6.3.0.01,5]undeca-3,9-diene-3-carboxylate |
|---|---|
| PubChem CID | 11053503 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl (1R,2R,5S,8S)-2,5-dimethyltricyclo[6.3.0.01,5]undeca-3,9-diene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@]2(C)CC[C@H]3C=CC[C@]32[C@H]1C |
| InChI | InChI=1S/C15H20O2/c1-10-12(13(16)17-3)9-14(2)8-6-11-5-4-7-15(10,11)14/h4-5,9-11H,6-8H2,1-3H3/t10-,11+,14-,15-/m0/s1 |
| InChIKey | YSKRBZCKJLOUMY-JLUCKKNBSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|