C19H22N2O — CID 110538872
5,6-dimethyl-2-[2-(2-methylpropoxy)phenyl]-1H-benzimidazole (PubChem CID 110538872) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 5,6-dimethyl-2-[2-(2-methylpropoxy)phenyl]-1H-benzimidazole.
| Compound Name | 5,6-dimethyl-2-[2-(2-methylpropoxy)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 110538872 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5,6-dimethyl-2-[2-(2-methylpropoxy)phenyl]-1H-benzimidazole |
| SMILES | Cc1cc2nc(-c3ccccc3OCC(C)C)[nH]c2cc1C |
| InChI | InChI=1S/C19H22N2O/c1-12(2)11-22-18-8-6-5-7-15(18)19-20-16-9-13(3)14(4)10-17(16)21-19/h5-10,12H,11H2,1-4H3,(H,20,21) |
| InChIKey | MDCQVMINADMMDJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |