C15H12ClNO2 — CID 110539671
2-(3-chloro-4-hydroxyphenyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 110539671) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyphenyl)-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | 2-(3-chloro-4-hydroxyphenyl)-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 110539671 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-(3-chloro-4-hydroxyphenyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1CC(c2ccc(O)c(Cl)c2)Nc2ccccc21 |
| InChI | InChI=1S/C15H12ClNO2/c16-11-7-9(5-6-14(11)18)13-8-15(19)10-3-1-2-4-12(10)17-13/h1-7,13,17-18H,8H2 |
| InChIKey | PWVPXPDRHNVCDY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |