C14H12NO — CID 56964004
CID 56964004 (PubChem CID 56964004) has the molecular formula C14H12NO and a molecular weight of 210.26 g/mol.
| Compound Name | CID 56964004 |
|---|---|
| PubChem CID | 56964004 |
| Molecular Formula | C14H12NO |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | — |
| SMILES | O=C1CC([C]2[CH][CH][CH][CH]2)Nc2ccccc21 |
| InChI | InChI=1S/C14H12NO/c16-14-9-13(10-5-1-2-6-10)15-12-8-4-3-7-11(12)14/h1-8,13,15H,9H2 |
| InChIKey | MAMFDJIPCOAPAR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |