About CID 56964004
CID 56964004 (PubChem CID 56964004) has the molecular formula C14H12NO
and a molecular weight of 210.26 g/mol.
Molecular Properties
| Compound Name | CID 56964004 |
| PubChem CID | 56964004 |
| Molecular Formula | C14H12NO |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | — |
| SMILES | O=C1CC([C]2[CH][CH][CH][CH]2)Nc2ccccc21 |
| InChI | InChI=1S/C14H12NO/c16-14-9-13(10-5-1-2-6-10)15-12-8-4-3-7-11(12)14/h1-8,13,15H,9H2 |
| InChIKey | MAMFDJIPCOAPAR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 56964004 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56964004?
The IUPAC name of CID 56964004 (CID 56964004) is not available.
What is the SMILES notation for CID 56964004?
The canonical SMILES for CID 56964004 is O=C1CC([C]2[CH][CH][CH][CH]2)Nc2ccccc21.
What is the InChIKey of CID 56964004?
The InChIKey is MAMFDJIPCOAPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12NO/c16-14-9-13(10-5-1-2-6-10)15-12-8-4-3-7-11(12)14/h1-8,13,15H,9H2.
What are the key properties of CID 56964004?
CID 56964004 has a molecular weight of 210.26 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56964004 is sourced from PubChem (CID 56964004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).