C19H22N2O4 — CID 142932748
2-(2,3-dihydro-1H-benzimidazol-2-yl)-2,3-dihydronaphthalene-1,4-dione;methanol (PubChem CID 142932748) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-benzimidazol-2-yl)-2,3-dihydronaphthalene-1,4-dione;methanol.
| Compound Name | 2-(2,3-dihydro-1H-benzimidazol-2-yl)-2,3-dihydronaphthalene-1,4-dione;methanol |
|---|---|
| PubChem CID | 142932748 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(2,3-dihydro-1H-benzimidazol-2-yl)-2,3-dihydronaphthalene-1,4-dione;methanol |
| SMILES | CO.CO.O=C1CC(C2Nc3ccccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O2.2CH4O/c20-15-9-12(16(21)11-6-2-1-5-10(11)15)17-18-13-7-3-4-8-14(13)19-17;2*1-2/h1-8,12,17-19H,9H2;2*2H,1H3 |
| InChIKey | GNFGECFGJZAARZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|