C15H13FNO2- — CID 139262353
2-(4-oxo-2,3-dihydro-1H-quinolin-2-yl)phenolate;hydrofluoride (PubChem CID 139262353) has the molecular formula C15H13FNO2- and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(4-oxo-2,3-dihydro-1H-quinolin-2-yl)phenolate;hydrofluoride.
| Compound Name | 2-(4-oxo-2,3-dihydro-1H-quinolin-2-yl)phenolate;hydrofluoride |
|---|---|
| PubChem CID | 139262353 |
| Molecular Formula | C15H13FNO2- |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(4-oxo-2,3-dihydro-1H-quinolin-2-yl)phenolate;hydrofluoride |
| SMILES | F.O=C1CC(c2ccccc2[O-])Nc2ccccc21 |
| InChI | InChI=1S/C15H13NO2.FH/c17-14-8-4-2-6-11(14)13-9-15(18)10-5-1-3-7-12(10)16-13;/h1-8,13,16-17H,9H2;1H/p-1 |
| InChIKey | XXVZEWVWJOPTKQ-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |