C16H11N3O — CID 11054437
1-(2-methylphenyl)azeto[2,3-b][1,8]naphthyridin-2-one (PubChem CID 11054437) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-(2-methylphenyl)azeto[2,3-b][1,8]naphthyridin-2-one.
| Compound Name | 1-(2-methylphenyl)azeto[2,3-b][1,8]naphthyridin-2-one |
|---|---|
| PubChem CID | 11054437 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-(2-methylphenyl)azeto[2,3-b][1,8]naphthyridin-2-one |
| SMILES | Cc1ccccc1N1C(=O)c2cc3cccnc3nc21 |
| InChI | InChI=1S/C16H11N3O/c1-10-5-2-3-7-13(10)19-15-12(16(19)20)9-11-6-4-8-17-14(11)18-15/h2-9H,1H3 |
| InChIKey | CXEKZMWSIZNMED-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |