C15H28O4 — CID 11054818
methyl (4S)-4-[(2R,6R)-6-tert-butyloxan-2-yl]oxypentanoate (PubChem CID 11054818) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is methyl (4S)-4-[(2R,6R)-6-tert-butyloxan-2-yl]oxypentanoate.
| Compound Name | methyl (4S)-4-[(2R,6R)-6-tert-butyloxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 11054818 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | methyl (4S)-4-[(2R,6R)-6-tert-butyloxan-2-yl]oxypentanoate |
| SMILES | COC(=O)CC[C@H](C)O[C@H]1CCC[C@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C15H28O4/c1-11(9-10-13(16)17-5)18-14-8-6-7-12(19-14)15(2,3)4/h11-12,14H,6-10H2,1-5H3/t11-,12+,14+/m0/s1 |
| InChIKey | VMGQNYKKZMMVRN-OUCADQQQSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |