C14H26O4 — CID 15827852
ethyl 2-[(2R,6S)-6-tert-butyloxan-2-yl]oxypropanoate (PubChem CID 15827852) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is ethyl 2-[(2R,6S)-6-tert-butyloxan-2-yl]oxypropanoate.
| Compound Name | ethyl 2-[(2R,6S)-6-tert-butyloxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 15827852 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | ethyl 2-[(2R,6S)-6-tert-butyloxan-2-yl]oxypropanoate |
| SMILES | CCOC(=O)C(C)O[C@@H]1CCC[C@@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C14H26O4/c1-6-16-13(15)10(2)17-12-9-7-8-11(18-12)14(3,4)5/h10-12H,6-9H2,1-5H3/t10?,11-,12-/m0/s1 |
| InChIKey | QBAWNFSOPPYEHO-RAMGSTBQSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |