C13H24O4Si — CID 11054822
2-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]acetaldehyde (PubChem CID 11054822) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11054822 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-oxooxan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)CCO[C@H]1CC=O |
| InChI | InChI=1S/C13H24O4Si/c1-13(2,3)18(4,5)17-12-10(15)7-9-16-11(12)6-8-14/h8,11-12H,6-7,9H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | NTTJEAPSSZRNHH-RYUDHWBXSA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|