C14H28O4Si — CID 23253063
(2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-6-methyloxan-4-one (PubChem CID 23253063) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-6-methyloxan-4-one.
| Compound Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-6-methyloxan-4-one |
|---|---|
| PubChem CID | 23253063 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2R,3R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-6-methyloxan-4-one |
| SMILES | CO[C@H]1C(=O)C[C@@H](C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O4Si/c1-10-8-11(15)13(16-5)12(18-10)9-17-19(6,7)14(2,3)4/h10,12-13H,8-9H2,1-7H3/t10-,12-,13+/m1/s1 |
| InChIKey | OFNXJPKVIPPREO-RTXFEEFZSA-N |
| XLogP | 2.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|