C15H27O4Si+ — CID 134857277
(4aR,6S,8aR)-2-tert-butyl-6-methyl-2-(2-methylpropan-2-yl)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one (PubChem CID 134857277) has the molecular formula C15H27O4Si+ and a molecular weight of 299.46 g/mol. Its IUPAC name is (4aR,6S,8aR)-2-tert-butyl-6-methyl-2-(2-methylpropan-2-yl)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one.
| Compound Name | (4aR,6S,8aR)-2-tert-butyl-6-methyl-2-(2-methylpropan-2-yl)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one |
|---|---|
| PubChem CID | 134857277 |
| Molecular Formula | C15H27O4Si+ |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (4aR,6S,8aR)-2-tert-butyl-6-methyl-2-(2-methylpropan-2-yl)-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one |
| SMILES | [CH2+]C(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](C)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H27O4Si/c1-10-8-11(16)13-12(18-10)9-17-20(19-13,14(2,3)4)15(5,6)7/h10,12-13H,2,8-9H2,1,3-7H3/q+1/t10-,12+,13-,20?/m0/s1 |
| InChIKey | RIZGQKMEIAOEMI-RNVOSHQWSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|