C15H28O4Si — CID 46909604
(4aR,6S,8aR)-2,2-ditert-butyl-6-methyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one (PubChem CID 46909604) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (4aR,6S,8aR)-2,2-ditert-butyl-6-methyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one.
| Compound Name | (4aR,6S,8aR)-2,2-ditert-butyl-6-methyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one |
|---|---|
| PubChem CID | 46909604 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (4aR,6S,8aR)-2,2-ditert-butyl-6-methyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-8-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C15H28O4Si/c1-10-8-11(16)13-12(18-10)9-17-20(19-13,14(2,3)4)15(5,6)7/h10,12-13H,8-9H2,1-7H3/t10-,12+,13-/m0/s1 |
| InChIKey | KVJPHCBQUJHGPF-UHTWSYAYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|