C16H30O2Si — CID 11055137
tert-butyl-[(6-butyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]-dimethylsilane (PubChem CID 11055137) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is tert-butyl-[(6-butyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(6-butyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11055137 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | tert-butyl-[(6-butyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]-dimethylsilane |
| SMILES | CCCCC12CCC=C(O[Si](C)(C)C(C)(C)C)C1O2 |
| InChI | InChI=1S/C16H30O2Si/c1-7-8-11-16-12-9-10-13(14(16)17-16)18-19(5,6)15(2,3)4/h10,14H,7-9,11-12H2,1-6H3 |
| InChIKey | GBZOWFVIWBJLBW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|