C23H26N2O4S — CID 110552418
3-[3-(hydroxymethyl)piperidin-1-yl]-1-[2-(4-methoxyphenyl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552418) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)piperidin-1-yl]-1-[2-(4-methoxyphenyl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-1-[2-(4-methoxyphenyl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552418 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-1-[2-(4-methoxyphenyl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C(c3cccs3)=C(N3CCCC(CO)C3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-29-18-8-6-16(7-9-18)10-12-25-22(27)20(19-5-3-13-30-19)21(23(25)28)24-11-2-4-17(14-24)15-26/h3,5-9,13,17,26H,2,4,10-12,14-15H2,1H3 |
| InChIKey | RZLZTEXZAWBKPC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|