C23H24N2O2S — CID 110553544
3-(4-benzylpiperidin-1-yl)-1-prop-2-enyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553544) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-prop-2-enyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-prop-2-enyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553544 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-prop-2-enyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(c2cccs2)=C(N2CCC(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H24N2O2S/c1-2-12-25-22(26)20(19-9-6-15-28-19)21(23(25)27)24-13-10-18(11-14-24)16-17-7-4-3-5-8-17/h2-9,15,18H,1,10-14,16H2 |
| InChIKey | GQBNUTPJYHZQTL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|