C20H19Cl2N3O3S — CID 110554102
1-(3,5-dichlorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554102) has the molecular formula C20H19Cl2N3O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554102 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2cccs2)=C(N2CCN(CCO)CC2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O3S/c21-13-10-14(22)12-15(11-13)25-19(27)17(16-2-1-9-29-16)18(20(25)28)24-5-3-23(4-6-24)7-8-26/h1-2,9-12,26H,3-8H2 |
| InChIKey | CVPNNNMGRIRSOA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|