C22H23N3O6 — CID 110562716
N-[4-[1-methyl-2,5-dioxo-4-(3,4,5-trimethoxyanilino)pyrrol-3-yl]phenyl]acetamide (PubChem CID 110562716) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[4-[1-methyl-2,5-dioxo-4-(3,4,5-trimethoxyanilino)pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-methyl-2,5-dioxo-4-(3,4,5-trimethoxyanilino)pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562716 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[4-[1-methyl-2,5-dioxo-4-(3,4,5-trimethoxyanilino)pyrrol-3-yl]phenyl]acetamide |
| SMILES | COc1cc(NC2=C(c3ccc(NC(C)=O)cc3)C(=O)N(C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O6/c1-12(26)23-14-8-6-13(7-9-14)18-19(22(28)25(2)21(18)27)24-15-10-16(29-3)20(31-5)17(11-15)30-4/h6-11,24H,1-5H3,(H,23,26) |
| InChIKey | HBVDUCIVSUBTGF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|