C22H20N2O6 — CID 110564527
3-(1,3-benzodioxol-5-ylamino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110564527) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564527 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2ccc3c(c2)OCO3)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H20N2O6/c1-4-9-24-21(25)19(13-5-7-15(27-2)17(10-13)28-3)20(22(24)26)23-14-6-8-16-18(11-14)30-12-29-16/h4-8,10-11,23H,1,9,12H2,2-3H3 |
| InChIKey | QDPOJNSRZSEHLE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|