C23H23N3O5 — CID 110596555
N-[4-[4-(2,5-dimethoxyanilino)-2,5-dioxo-1-prop-2-enylpyrrol-3-yl]phenyl]acetamide (PubChem CID 110596555) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[4-[4-(2,5-dimethoxyanilino)-2,5-dioxo-1-prop-2-enylpyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(2,5-dimethoxyanilino)-2,5-dioxo-1-prop-2-enylpyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110596555 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[4-[4-(2,5-dimethoxyanilino)-2,5-dioxo-1-prop-2-enylpyrrol-3-yl]phenyl]acetamide |
| SMILES | C=CCN1C(=O)C(Nc2cc(OC)ccc2OC)=C(c2ccc(NC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C23H23N3O5/c1-5-12-26-22(28)20(15-6-8-16(9-7-15)24-14(2)27)21(23(26)29)25-18-13-17(30-3)10-11-19(18)31-4/h5-11,13,25H,1,12H2,2-4H3,(H,24,27) |
| InChIKey | OFPHEIWGWIVFRS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|