C22H21ClN2O5 — CID 110597100
3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110597100) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110597100 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2ccc(OC)c(Cl)c2)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H21ClN2O5/c1-5-10-25-21(26)19(13-6-8-17(29-3)18(11-13)30-4)20(22(25)27)24-14-7-9-16(28-2)15(23)12-14/h5-9,11-12,24H,1,10H2,2-4H3 |
| InChIKey | HYOPMOVPNFSRKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|