C21H19NO4S — CID 110564529
3-(3,4-dimethoxyphenyl)-4-phenylsulfanyl-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110564529) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-phenylsulfanyl-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-phenylsulfanyl-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564529 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-phenylsulfanyl-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Sc2ccccc2)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C21H19NO4S/c1-4-12-22-20(23)18(14-10-11-16(25-2)17(13-14)26-3)19(21(22)24)27-15-8-6-5-7-9-15/h4-11,13H,1,12H2,2-3H3 |
| InChIKey | MKLOISRMQQDFPI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|