C21H18ClNO4S — CID 110564530
3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110564530) has the molecular formula C21H18ClNO4S and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564530 |
| Molecular Formula | C21H18ClNO4S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-4-(3,4-dimethoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Sc2ccc(Cl)cc2)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C21H18ClNO4S/c1-4-11-23-20(24)18(13-5-10-16(26-2)17(12-13)27-3)19(21(23)25)28-15-8-6-14(22)7-9-15/h4-10,12H,1,11H2,2-3H3 |
| InChIKey | VVGCYFJRRTWTHV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|