C23H25NO5S — CID 110566565
1-[(3,4-dimethoxyphenyl)methyl]-3-(2-methoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione (PubChem CID 110566565) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-methoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-methoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566565 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-methoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C(SC(C)C)=C(c3ccccc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C23H25NO5S/c1-14(2)30-21-20(16-8-6-7-9-17(16)27-3)22(25)24(23(21)26)13-15-10-11-18(28-4)19(12-15)29-5/h6-12,14H,13H2,1-5H3 |
| InChIKey | DDHXHVZSGQFOCO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|